C14H19N5O2S — CID 19353515
4-amino-N-[2-(ethylamino)-6-(methylamino)-4-pyridinyl]benzenesulfonamide (PubChem CID 19353515) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 4-amino-N-[2-(ethylamino)-6-(methylamino)-4-pyridinyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-(ethylamino)-6-(methylamino)-4-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19353515 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-amino-N-[2-(ethylamino)-6-(methylamino)-4-pyridinyl]benzenesulfonamide |
| SMILES | CCNc1cc(NS(=O)(=O)c2ccc(N)cc2)cc(NC)n1 |
| InChI | InChI=1S/C14H19N5O2S/c1-3-17-14-9-11(8-13(16-2)18-14)19-22(20,21)12-6-4-10(15)5-7-12/h4-9H,3,15H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | PKNBSHXKCVHIEG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|