C22H29ClO — CID 140982124
2,4-dibutyl-6-(4-chlorophenyl)-3-ethylphenol (PubChem CID 140982124) has the molecular formula C22H29ClO and a molecular weight of 344.93 g/mol. Its IUPAC name is 2,4-dibutyl-6-(4-chlorophenyl)-3-ethylphenol.
| Compound Name | 2,4-dibutyl-6-(4-chlorophenyl)-3-ethylphenol |
|---|---|
| PubChem CID | 140982124 |
| Molecular Formula | C22H29ClO |
| Molecular Weight | 344.93 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2,4-dibutyl-6-(4-chlorophenyl)-3-ethylphenol |
| SMILES | CCCCc1cc(-c2ccc(Cl)cc2)c(O)c(CCCC)c1CC |
| InChI | InChI=1S/C22H29ClO/c1-4-7-9-17-15-21(16-11-13-18(23)14-12-16)22(24)20(10-8-5-2)19(17)6-3/h11-15,24H,4-10H2,1-3H3 |
| InChIKey | IWYVYVZCNXGKPJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.93 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |