C13H12Cl2F3N3O2 — CID 140982197
5-acetyl-1-amino-4-methyl-6-(3,4,5-trifluorophenyl)pyrimidin-2-one;dihydrochloride (PubChem CID 140982197) has the molecular formula C13H12Cl2F3N3O2 and a molecular weight of 370.16 g/mol. Its IUPAC name is 5-acetyl-1-amino-4-methyl-6-(3,4,5-trifluorophenyl)pyrimidin-2-one;dihydrochloride.
| Compound Name | 5-acetyl-1-amino-4-methyl-6-(3,4,5-trifluorophenyl)pyrimidin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 140982197 |
| Molecular Formula | C13H12Cl2F3N3O2 |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 5-acetyl-1-amino-4-methyl-6-(3,4,5-trifluorophenyl)pyrimidin-2-one;dihydrochloride |
| SMILES | CC(=O)c1c(C)nc(=O)n(N)c1-c1cc(F)c(F)c(F)c1.Cl.Cl |
| InChI | InChI=1S/C13H10F3N3O2.2ClH/c1-5-10(6(2)20)12(19(17)13(21)18-5)7-3-8(14)11(16)9(15)4-7;;/h3-4H,17H2,1-2H3;2*1H |
| InChIKey | GIERLAKOZNOVBK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|