C26H34N2O6 — CID 140982498
3-[2-hydroxy-3-(octylcarbamoyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 140982498) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(octylcarbamoyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[2-hydroxy-3-(octylcarbamoyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 140982498 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 3-[2-hydroxy-3-(octylcarbamoyl)phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CCCCCCCCNC(=O)c1cccc(CC(NC(=O)OCc2ccccc2)C(=O)O)c1O |
| InChI | InChI=1S/C26H34N2O6/c1-2-3-4-5-6-10-16-27-24(30)21-15-11-14-20(23(21)29)17-22(25(31)32)28-26(33)34-18-19-12-8-7-9-13-19/h7-9,11-15,22,29H,2-6,10,16-18H2,1H3,(H,27,30)(H,28,33)(H,31,32) |
| InChIKey | JIXFALQRPBWBRC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|