C24H28N2O7 — CID 10766215
methyl (2S)-5-[[2-(2-methoxy-2-oxoethyl)benzoyl]amino]-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 10766215) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is methyl (2S)-5-[[2-(2-methoxy-2-oxoethyl)benzoyl]amino]-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2S)-5-[[2-(2-methoxy-2-oxoethyl)benzoyl]amino]-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 10766215 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | methyl (2S)-5-[[2-(2-methoxy-2-oxoethyl)benzoyl]amino]-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)Cc1ccccc1C(=O)NCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H28N2O7/c1-31-21(27)15-18-11-6-7-12-19(18)22(28)25-14-8-13-20(23(29)32-2)26-24(30)33-16-17-9-4-3-5-10-17/h3-7,9-12,20H,8,13-16H2,1-2H3,(H,25,28)(H,26,30)/t20-/m0/s1 |
| InChIKey | HSOHNWYWJIDZES-FQEVSTJZSA-N |
| XLogP | 2.38 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|