C10H9NO2S — CID 140982809
4-methyl-1-phenylsulfanylazetidine-2,3-dione (PubChem CID 140982809) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 4-methyl-1-phenylsulfanylazetidine-2,3-dione.
| Compound Name | 4-methyl-1-phenylsulfanylazetidine-2,3-dione |
|---|---|
| PubChem CID | 140982809 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 4-methyl-1-phenylsulfanylazetidine-2,3-dione |
| SMILES | CC1C(=O)C(=O)N1Sc1ccccc1 |
| InChI | InChI=1S/C10H9NO2S/c1-7-9(12)10(13)11(7)14-8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | VHIXMPBLQANTDU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|