C12H17NO2S — CID 142344019
formic acid;2-methyl-1-phenylsulfanylpyrrolidine (PubChem CID 142344019) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is formic acid;2-methyl-1-phenylsulfanylpyrrolidine.
| Compound Name | formic acid;2-methyl-1-phenylsulfanylpyrrolidine |
|---|---|
| PubChem CID | 142344019 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | formic acid;2-methyl-1-phenylsulfanylpyrrolidine |
| SMILES | CC1CCCN1Sc1ccccc1.O=CO |
| InChI | InChI=1S/C11H15NS.CH2O2/c1-10-6-5-9-12(10)13-11-7-3-2-4-8-11;2-1-3/h2-4,7-8,10H,5-6,9H2,1H3;1H,(H,2,3) |
| InChIKey | XHLRLXKTYMWHBP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|