C7H14ClN3O — CID 140987307
1,2,3-triazaspiro[4.5]decan-4-one;hydrochloride (PubChem CID 140987307) has the molecular formula C7H14ClN3O and a molecular weight of 191.66 g/mol. Its IUPAC name is 1,2,3-triazaspiro[4.5]decan-4-one;hydrochloride.
| Compound Name | 1,2,3-triazaspiro[4.5]decan-4-one;hydrochloride |
|---|---|
| PubChem CID | 140987307 |
| Molecular Formula | C7H14ClN3O |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1,2,3-triazaspiro[4.5]decan-4-one;hydrochloride |
| SMILES | Cl.O=C1NNNC12CCCCC2 |
| InChI | InChI=1S/C7H13N3O.ClH/c11-6-7(9-10-8-6)4-2-1-3-5-7;/h9-10H,1-5H2,(H,8,11);1H |
| InChIKey | USFKGNCUSRHUNC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |