About 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one
2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 170353552) has the molecular formula C8H11ClN2O
and a molecular weight of 186.64 g/mol. Its IUPAC name is 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one.
Molecular Properties
| Compound Name | 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
| PubChem CID | 170353552 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | O=C1NC(CCl)=NC12CCCC2 |
| InChI | InChI=1S/C8H11ClN2O/c9-5-6-10-7(12)8(11-6)3-1-2-4-8/h1-5H2,(H,10,11,12) |
| InChIKey | OBZJDMNLUWFSJE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
The IUPAC name of 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one (CID 170353552) is 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one.
What is the SMILES notation for 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
The canonical SMILES for 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one is O=C1NC(CCl)=NC12CCCC2.
What is the InChIKey of 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
The InChIKey is OBZJDMNLUWFSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O/c9-5-6-10-7(12)8(11-6)3-1-2-4-8/h1-5H2,(H,10,11,12).
What are the key properties of 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one?
2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one has a molecular weight of 186.64 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-1,3-diazaspiro[4.4]non-1-en-4-one is sourced from PubChem (CID 170353552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).