C13H17N2O5P — CID 140987840
5-(dimethoxyphosphorylmethyl)-2,3-dimethoxyquinoxaline (PubChem CID 140987840) has the molecular formula C13H17N2O5P and a molecular weight of 312.26 g/mol. Its IUPAC name is 5-(dimethoxyphosphorylmethyl)-2,3-dimethoxyquinoxaline.
| Compound Name | 5-(dimethoxyphosphorylmethyl)-2,3-dimethoxyquinoxaline |
|---|---|
| PubChem CID | 140987840 |
| Molecular Formula | C13H17N2O5P |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-(dimethoxyphosphorylmethyl)-2,3-dimethoxyquinoxaline |
| SMILES | COc1nc2cccc(CP(=O)(OC)OC)c2nc1OC |
| InChI | InChI=1S/C13H17N2O5P/c1-17-12-13(18-2)15-11-9(6-5-7-10(11)14-12)8-21(16,19-3)20-4/h5-7H,8H2,1-4H3 |
| InChIKey | XFLUNLJMYPWAAS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|