C12H10N4O4 — CID 72723728
2,3-dimethoxy-7,10-dihydropyrazino[2,3-f]quinoxaline-8,9-dione (PubChem CID 72723728) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,3-dimethoxy-7,10-dihydropyrazino[2,3-f]quinoxaline-8,9-dione.
| Compound Name | 2,3-dimethoxy-7,10-dihydropyrazino[2,3-f]quinoxaline-8,9-dione |
|---|---|
| PubChem CID | 72723728 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2,3-dimethoxy-7,10-dihydropyrazino[2,3-f]quinoxaline-8,9-dione |
| SMILES | COc1nc2ccc3[nH]c(=O)c(=O)[nH]c3c2nc1OC |
| InChI | InChI=1S/C12H10N4O4/c1-19-11-12(20-2)16-8-6(14-11)4-3-5-7(8)15-10(18)9(17)13-5/h3-4H,1-2H3,(H,13,17)(H,15,18) |
| InChIKey | BHNROUAZDGMUKK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|