C9H9N3O3 — CID 176774328
2,3-dimethoxy-6H-pyrido[3,4-b]pyrazin-5-one (PubChem CID 176774328) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 2,3-dimethoxy-6H-pyrido[3,4-b]pyrazin-5-one.
| Compound Name | 2,3-dimethoxy-6H-pyrido[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 176774328 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2,3-dimethoxy-6H-pyrido[3,4-b]pyrazin-5-one |
| SMILES | COc1nc2cc[nH]c(=O)c2nc1OC |
| InChI | InChI=1S/C9H9N3O3/c1-14-8-9(15-2)12-6-5(11-8)3-4-10-7(6)13/h3-4H,1-2H3,(H,10,13) |
| InChIKey | DGFYBJGNBMCJAI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |