C10H8ClIN2O2 — CID 151894659
6-chloro-5-iodo-2,3-dimethoxyquinoxaline (PubChem CID 151894659) has the molecular formula C10H8ClIN2O2 and a molecular weight of 350.54 g/mol. Its IUPAC name is 6-chloro-5-iodo-2,3-dimethoxyquinoxaline.
| Compound Name | 6-chloro-5-iodo-2,3-dimethoxyquinoxaline |
|---|---|
| PubChem CID | 151894659 |
| Molecular Formula | C10H8ClIN2O2 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 6-chloro-5-iodo-2,3-dimethoxyquinoxaline |
| SMILES | COc1nc2ccc(Cl)c(I)c2nc1OC |
| InChI | InChI=1S/C10H8ClIN2O2/c1-15-9-10(16-2)14-8-6(13-9)4-3-5(11)7(8)12/h3-4H,1-2H3 |
| InChIKey | SRLOTXPSVMMJEB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|