C7H7N3O2 — CID 152647551
2-methoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 152647551) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-methoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-methoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 152647551 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 2-methoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | COc1nc2cc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N3O2/c1-12-7-9-4-2-3-8-5(4)6(11)10-7/h2-3,8H,1H3,(H,9,10,11) |
| InChIKey | PXPZHUHJJCHHLW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |