C9H8N3ORe- — CID 149402130
2-ethyl-3,6-dihydropyrido[3,4-b]pyrazin-3-id-5-one;rhenium (PubChem CID 149402130) has the molecular formula C9H8N3ORe- and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-ethyl-3,6-dihydropyrido[3,4-b]pyrazin-3-id-5-one;rhenium.
| Compound Name | 2-ethyl-3,6-dihydropyrido[3,4-b]pyrazin-3-id-5-one;rhenium |
|---|---|
| PubChem CID | 149402130 |
| Molecular Formula | C9H8N3ORe- |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2-ethyl-3,6-dihydropyrido[3,4-b]pyrazin-3-id-5-one;rhenium |
| SMILES | CCc1[c-]nc2c(=O)[nH]ccc2n1.[Re] |
| InChI | InChI=1S/C9H8N3O.Re/c1-2-6-5-11-8-7(12-6)3-4-10-9(8)13;/h3-4H,2H2,1H3,(H,10,13);/q-1; |
| InChIKey | OTQNJTCTPFRVMX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|