C20H19N3O6 — CID 19043261
2,3,7,10,11-pentamethoxy-5H-pyrido[2,3-f][1,7]phenanthrolin-6-one (PubChem CID 19043261) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2,3,7,10,11-pentamethoxy-5H-pyrido[2,3-f][1,7]phenanthrolin-6-one.
| Compound Name | 2,3,7,10,11-pentamethoxy-5H-pyrido[2,3-f][1,7]phenanthrolin-6-one |
|---|---|
| PubChem CID | 19043261 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2,3,7,10,11-pentamethoxy-5H-pyrido[2,3-f][1,7]phenanthrolin-6-one |
| SMILES | COc1cc2c(nc1OC)c1cc(OC)c(OC)nc1c1cc(OC)c(=O)[nH]c21 |
| InChI | InChI=1S/C20H19N3O6/c1-25-12-6-9-15(21-18(12)24)10-7-13(26-2)19(28-4)23-17(10)11-8-14(27-3)20(29-5)22-16(9)11/h6-8H,1-5H3,(H,21,24) |
| InChIKey | VWEGLBJFTMAIFD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|