C18H15BrN2O3 — CID 140992885
4-(2-bromoethylamino)-2-oxo-1-phenylquinoline-3-carboxylic acid (PubChem CID 140992885) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is 4-(2-bromoethylamino)-2-oxo-1-phenylquinoline-3-carboxylic acid.
| Compound Name | 4-(2-bromoethylamino)-2-oxo-1-phenylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 140992885 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 4-(2-bromoethylamino)-2-oxo-1-phenylquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c(NCCBr)c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C18H15BrN2O3/c19-10-11-20-16-13-8-4-5-9-14(13)21(12-6-2-1-3-7-12)17(22)15(16)18(23)24/h1-9,20H,10-11H2,(H,23,24) |
| InChIKey | PDEMFYUFXKUFQM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|