C25H34N4O3 — CID 140993279
N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-methyl-4-phenoxypiperidine-1-carboxamide (PubChem CID 140993279) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-methyl-4-phenoxypiperidine-1-carboxamide.
| Compound Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-methyl-4-phenoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 140993279 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-methyl-4-phenoxypiperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC(Oc3ccccc3)CC2C)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H34N4O3/c1-19-17-22(32-21-7-5-4-6-8-21)11-12-29(19)25(30)26-20-9-10-24(31-3)23(18-20)28-15-13-27(2)14-16-28/h4-10,18-19,22H,11-17H2,1-3H3,(H,26,30) |
| InChIKey | INAYPOQJEJNKLI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |