C21H19FN2O3 — CID 140996317
2-(4-amino-2-fluorophenyl)-2-(5-benzoyl-1,4-dimethylpyrrol-2-yl)acetic acid (PubChem CID 140996317) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-(4-amino-2-fluorophenyl)-2-(5-benzoyl-1,4-dimethylpyrrol-2-yl)acetic acid.
| Compound Name | 2-(4-amino-2-fluorophenyl)-2-(5-benzoyl-1,4-dimethylpyrrol-2-yl)acetic acid |
|---|---|
| PubChem CID | 140996317 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(4-amino-2-fluorophenyl)-2-(5-benzoyl-1,4-dimethylpyrrol-2-yl)acetic acid |
| SMILES | Cc1cc(C(C(=O)O)c2ccc(N)cc2F)n(C)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19FN2O3/c1-12-10-17(18(21(26)27)15-9-8-14(23)11-16(15)22)24(2)19(12)20(25)13-6-4-3-5-7-13/h3-11,18H,23H2,1-2H3,(H,26,27) |
| InChIKey | FJZGMFCLGXLMMR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|