C15H23NO2 — CID 140997731
4,5-dicyclohexyl-3H-1,3-oxazol-2-one (PubChem CID 140997731) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4,5-dicyclohexyl-3H-1,3-oxazol-2-one.
| Compound Name | 4,5-dicyclohexyl-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 140997731 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4,5-dicyclohexyl-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]c(C2CCCCC2)c(C2CCCCC2)o1 |
| InChI | InChI=1S/C15H23NO2/c17-15-16-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h11-12H,1-10H2,(H,16,17) |
| InChIKey | JGMPPAXEVYOMMW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |