C10H16N2O — CID 105438957
4-cycloheptyl-1,3-dihydroimidazol-2-one (PubChem CID 105438957) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-cycloheptyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-cycloheptyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 105438957 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-cycloheptyl-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(C2CCCCCC2)[nH]1 |
| InChI | InChI=1S/C10H16N2O/c13-10-11-7-9(12-10)8-5-3-1-2-4-6-8/h7-8H,1-6H2,(H2,11,12,13) |
| InChIKey | YFZDCAFIKLGRNX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |