C11H18N2O — CID 105448418
4-cycloheptyl-5-methyl-1,3-dihydroimidazol-2-one (PubChem CID 105448418) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-cycloheptyl-5-methyl-1,3-dihydroimidazol-2-one.
| Compound Name | 4-cycloheptyl-5-methyl-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 105448418 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-cycloheptyl-5-methyl-1,3-dihydroimidazol-2-one |
| SMILES | Cc1[nH]c(=O)[nH]c1C1CCCCCC1 |
| InChI | InChI=1S/C11H18N2O/c1-8-10(13-11(14)12-8)9-6-4-2-3-5-7-9/h9H,2-7H2,1H3,(H2,12,13,14) |
| InChIKey | CTGIOQUSVCXLBZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |