C10H15NO2 — CID 105439472
4-cycloheptyl-3H-1,3-oxazol-2-one (PubChem CID 105439472) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 4-cycloheptyl-3H-1,3-oxazol-2-one.
| Compound Name | 4-cycloheptyl-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 105439472 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 4-cycloheptyl-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]c(C2CCCCCC2)co1 |
| InChI | InChI=1S/C10H15NO2/c12-10-11-9(7-13-10)8-5-3-1-2-4-6-8/h7-8H,1-6H2,(H,11,12) |
| InChIKey | CSNWDGIPMLIEJX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |