C9H14ClN3O — CID 141001477
3-[[(2S)-azetidin-2-yl]methoxy]pyridin-2-amine;hydrochloride (PubChem CID 141001477) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 3-[[(2S)-azetidin-2-yl]methoxy]pyridin-2-amine;hydrochloride.
| Compound Name | 3-[[(2S)-azetidin-2-yl]methoxy]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 141001477 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-[[(2S)-azetidin-2-yl]methoxy]pyridin-2-amine;hydrochloride |
| SMILES | Cl.Nc1ncccc1OC[C@@H]1CCN1 |
| InChI | InChI=1S/C9H13N3O.ClH/c10-9-8(2-1-4-12-9)13-6-7-3-5-11-7;/h1-2,4,7,11H,3,5-6H2,(H2,10,12);1H/t7-;/m0./s1 |
| InChIKey | JRWBIZCMUOBPPK-FJXQXJEOSA-N |
| XLogP | 0.83 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |