C15H13N3O3S — CID 141002200
2,3-dihydroindol-1-yl 3H-benzimidazole-5-sulfonate (PubChem CID 141002200) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl 3H-benzimidazole-5-sulfonate.
| Compound Name | 2,3-dihydroindol-1-yl 3H-benzimidazole-5-sulfonate |
|---|---|
| PubChem CID | 141002200 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2,3-dihydroindol-1-yl 3H-benzimidazole-5-sulfonate |
| SMILES | O=S(=O)(ON1CCc2ccccc21)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C15H13N3O3S/c19-22(20,12-5-6-13-14(9-12)17-10-16-13)21-18-8-7-11-3-1-2-4-15(11)18/h1-6,9-10H,7-8H2,(H,16,17) |
| InChIKey | SRZFNZCGHYDDLG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |