About 2,3-dihydroindol-1-yl iodate
2,3-dihydroindol-1-yl iodate (PubChem CID 141076432) has the molecular formula C8H8INO3
and a molecular weight of 293.06 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl iodate.
Molecular Properties
| Compound Name | 2,3-dihydroindol-1-yl iodate |
| PubChem CID | 141076432 |
| Molecular Formula | C8H8INO3 |
| Molecular Weight | 293.06 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | 2,3-dihydroindol-1-yl iodate |
| SMILES | [O-][I+2]([O-])ON1CCc2ccccc21 |
| InChI | InChI=1S/C8H8INO3/c11-9(12)13-10-6-5-7-3-1-2-4-8(7)10/h1-4H,5-6H2 |
| InChIKey | VEXIWHGSYFHVEF-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.06 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroindol-1-yl iodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroindol-1-yl iodate?
The IUPAC name of 2,3-dihydroindol-1-yl iodate (CID 141076432) is 2,3-dihydroindol-1-yl iodate.
What is the SMILES notation for 2,3-dihydroindol-1-yl iodate?
The canonical SMILES for 2,3-dihydroindol-1-yl iodate is [O-][I+2]([O-])ON1CCc2ccccc21.
What is the InChIKey of 2,3-dihydroindol-1-yl iodate?
The InChIKey is VEXIWHGSYFHVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO3/c11-9(12)13-10-6-5-7-3-1-2-4-8(7)10/h1-4H,5-6H2.
What are the key properties of 2,3-dihydroindol-1-yl iodate?
2,3-dihydroindol-1-yl iodate has a molecular weight of 293.06 g/mol, XLogP of -3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroindol-1-yl iodate is sourced from PubChem (CID 141076432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).