C11H16N2O — CID 68627296
2-ethoxy-1-methyl-3,4-dihydrocinnoline (PubChem CID 68627296) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethoxy-1-methyl-3,4-dihydrocinnoline.
| Compound Name | 2-ethoxy-1-methyl-3,4-dihydrocinnoline |
|---|---|
| PubChem CID | 68627296 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-ethoxy-1-methyl-3,4-dihydrocinnoline |
| SMILES | CCON1CCc2ccccc2N1C |
| InChI | InChI=1S/C11H16N2O/c1-3-14-13-9-8-10-6-4-5-7-11(10)12(13)2/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | OPZXDCUESVKSJK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |