C16H12FN3O — CID 110742263
3H-benzimidazol-5-yl-(5-fluoro-2,3-dihydroindol-1-yl)methanone (PubChem CID 110742263) has the molecular formula C16H12FN3O and a molecular weight of 281.29 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-(5-fluoro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | 3H-benzimidazol-5-yl-(5-fluoro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110742263 |
| Molecular Formula | C16H12FN3O |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3H-benzimidazol-5-yl-(5-fluoro-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C16H12FN3O/c17-12-2-4-15-10(7-12)5-6-20(15)16(21)11-1-3-13-14(8-11)19-9-18-13/h1-4,7-9H,5-6H2,(H,18,19) |
| InChIKey | PRZQDIYFLCRDDV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |