C24H21FN2O2 — CID 175217591
N-[1-(1-benzoyl-2,3-dihydroindol-5-yl)ethyl]-4-fluorobenzamide (PubChem CID 175217591) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-[1-(1-benzoyl-2,3-dihydroindol-5-yl)ethyl]-4-fluorobenzamide.
| Compound Name | N-[1-(1-benzoyl-2,3-dihydroindol-5-yl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 175217591 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[1-(1-benzoyl-2,3-dihydroindol-5-yl)ethyl]-4-fluorobenzamide |
| SMILES | CC(NC(=O)c1ccc(F)cc1)c1ccc2c(c1)CCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21FN2O2/c1-16(26-23(28)17-7-10-21(25)11-8-17)19-9-12-22-20(15-19)13-14-27(22)24(29)18-5-3-2-4-6-18/h2-12,15-16H,13-14H2,1H3,(H,26,28) |
| InChIKey | SLMGXJFZXFFOBE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |