C7H3F3N4O — CID 141002928
2,2,2-trifluoro-1-purin-1-ylethanone (PubChem CID 141002928) has the molecular formula C7H3F3N4O and a molecular weight of 216.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-purin-1-ylethanone.
| Compound Name | 2,2,2-trifluoro-1-purin-1-ylethanone |
|---|---|
| PubChem CID | 141002928 |
| Molecular Formula | C7H3F3N4O |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2,2,2-trifluoro-1-purin-1-ylethanone |
| SMILES | O=C(n1cnc2ncnc-2c1)C(F)(F)F |
| InChI | InChI=1S/C7H3F3N4O/c8-7(9,10)6(15)14-1-4-5(13-3-14)12-2-11-4/h1-3H |
| InChIKey | FGTSZXHGRJAGBH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |