C16H11F4NO — CID 141006788
5-ethyl-1-(2,3,5,6-tetrafluorophenyl)indol-2-ol (PubChem CID 141006788) has the molecular formula C16H11F4NO and a molecular weight of 309.26 g/mol. Its IUPAC name is 5-ethyl-1-(2,3,5,6-tetrafluorophenyl)indol-2-ol.
| Compound Name | 5-ethyl-1-(2,3,5,6-tetrafluorophenyl)indol-2-ol |
|---|---|
| PubChem CID | 141006788 |
| Molecular Formula | C16H11F4NO |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-ethyl-1-(2,3,5,6-tetrafluorophenyl)indol-2-ol |
| SMILES | CCc1ccc2c(c1)cc(O)n2-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H11F4NO/c1-2-8-3-4-12-9(5-8)6-13(22)21(12)16-14(19)10(17)7-11(18)15(16)20/h3-7,22H,2H2,1H3 |
| InChIKey | CDZPVMXPNBKLKK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|