C13H22O3 — CID 141007685
3-[1-(2-butyl-1,3-dioxol-2-yl)cyclopropyl]propan-1-ol (PubChem CID 141007685) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[1-(2-butyl-1,3-dioxol-2-yl)cyclopropyl]propan-1-ol.
| Compound Name | 3-[1-(2-butyl-1,3-dioxol-2-yl)cyclopropyl]propan-1-ol |
|---|---|
| PubChem CID | 141007685 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 3-[1-(2-butyl-1,3-dioxol-2-yl)cyclopropyl]propan-1-ol |
| SMILES | CCCCC1(C2(CCCO)CC2)OC=CO1 |
| InChI | InChI=1S/C13H22O3/c1-2-3-6-13(15-10-11-16-13)12(7-8-12)5-4-9-14/h10-11,14H,2-9H2,1H3 |
| InChIKey | BRDGJLAVMSAUDT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |