C7H17N3O — CID 141009114
N'-(1-hydroxypiperidin-2-yl)ethane-1,2-diamine (PubChem CID 141009114) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is N'-(1-hydroxypiperidin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(1-hydroxypiperidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 141009114 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | N'-(1-hydroxypiperidin-2-yl)ethane-1,2-diamine |
| SMILES | NCCNC1CCCCN1O |
| InChI | InChI=1S/C7H17N3O/c8-4-5-9-7-3-1-2-6-10(7)11/h7,9,11H,1-6,8H2 |
| InChIKey | KJNUWOYSMOBNPS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |