About 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid
2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid (PubChem CID 141009839) has the molecular formula C22H23NO4S
and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid.
Molecular Properties
| Compound Name | 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid |
| PubChem CID | 141009839 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)S(=O)(=O)N1CC=C(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H23NO4S/c1-2-6-21(22(24)25)28(26,27)23-15-13-20(14-16-23)19-11-9-18(10-12-19)17-7-4-3-5-8-17/h2-5,7-13,21H,1,6,14-16H2,(H,24,25) |
| InChIKey | DUIAUMFUWZMMJZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid?
The IUPAC name of 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid (CID 141009839) is 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid.
What is the SMILES notation for 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid?
The canonical SMILES for 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid is C=CCC(C(=O)O)S(=O)(=O)N1CC=C(c2ccc(-c3ccccc3)cc2)CC1.
What is the InChIKey of 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid?
The InChIKey is DUIAUMFUWZMMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO4S/c1-2-6-21(22(24)25)28(26,27)23-15-13-20(14-16-23)19-11-9-18(10-12-19)17-7-4-3-5-8-17/h2-5,7-13,21H,1,6,14-16H2,(H,24,25).
What are the key properties of 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid?
2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid has a molecular weight of 397.50 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(4-phenylphenyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]pent-4-enoic acid is sourced from PubChem (CID 141009839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).