C11H11N3O — CID 141010100
1-ethenyl-5-(4-methoxyphenyl)-1,2,4-triazole (PubChem CID 141010100) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-ethenyl-5-(4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 1-ethenyl-5-(4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 141010100 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-ethenyl-5-(4-methoxyphenyl)-1,2,4-triazole |
| SMILES | C=Cn1ncnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H11N3O/c1-3-14-11(12-8-13-14)9-4-6-10(15-2)7-5-9/h3-8H,1H2,2H3 |
| InChIKey | NQCYBEQPZJWYKX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |