C10H8N2O3 — CID 141014414
[1,3]dioxolo[4,5-f]indole-5-carboxamide (PubChem CID 141014414) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-f]indole-5-carboxamide.
| Compound Name | [1,3]dioxolo[4,5-f]indole-5-carboxamide |
|---|---|
| PubChem CID | 141014414 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | [1,3]dioxolo[4,5-f]indole-5-carboxamide |
| SMILES | NC(=O)n1ccc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C10H8N2O3/c11-10(13)12-2-1-6-3-8-9(4-7(6)12)15-5-14-8/h1-4H,5H2,(H2,11,13) |
| InChIKey | FIVDDDDHGNBUKY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |