C12H11NO3 — CID 11229685
1-(5-methyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethanone (PubChem CID 11229685) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(5-methyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethanone.
| Compound Name | 1-(5-methyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethanone |
|---|---|
| PubChem CID | 11229685 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-(5-methyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethanone |
| SMILES | CC(=O)c1cc2cc3c(cc2n1C)OCO3 |
| InChI | InChI=1S/C12H11NO3/c1-7(14)9-3-8-4-11-12(16-6-15-11)5-10(8)13(9)2/h3-5H,6H2,1-2H3 |
| InChIKey | YTDNCDBLGQYZEV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |