C14H15NO3 — CID 82497831
1-(5,6-dimethyl-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-one (PubChem CID 82497831) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(5,6-dimethyl-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-one.
| Compound Name | 1-(5,6-dimethyl-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-one |
|---|---|
| PubChem CID | 82497831 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(5,6-dimethyl-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-one |
| SMILES | CC(=O)Cc1c(C)n(C)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C14H15NO3/c1-8(16)4-10-9(2)15(3)12-6-14-13(5-11(10)12)17-7-18-14/h5-6H,4,7H2,1-3H3 |
| InChIKey | NFOKAGDLGLBEHS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|