C7H13IO5 — CID 141014802
(2R,3S,4R,5S,6S)-6-(iodomethyl)-5-methoxyoxane-2,3,4-triol (PubChem CID 141014802) has the molecular formula C7H13IO5 and a molecular weight of 304.08 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-6-(iodomethyl)-5-methoxyoxane-2,3,4-triol.
| Compound Name | (2R,3S,4R,5S,6S)-6-(iodomethyl)-5-methoxyoxane-2,3,4-triol |
|---|---|
| PubChem CID | 141014802 |
| Molecular Formula | C7H13IO5 |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | (2R,3S,4R,5S,6S)-6-(iodomethyl)-5-methoxyoxane-2,3,4-triol |
| SMILES | CO[C@H]1[C@H](O)[C@H](O)[C@H](O)O[C@@H]1CI |
| InChI | InChI=1S/C7H13IO5/c1-12-6-3(2-8)13-7(11)5(10)4(6)9/h3-7,9-11H,2H2,1H3/t3-,4-,5+,6-,7-/m1/s1 |
| InChIKey | UKGSJORKEHBLMM-XUUWZHRGSA-N |
| XLogP | -1.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|