C7H14O4 — CID 74429889
5-ethyl-4-methoxyoxolane-2,3-diol (PubChem CID 74429889) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is 5-ethyl-4-methoxyoxolane-2,3-diol.
| Compound Name | 5-ethyl-4-methoxyoxolane-2,3-diol |
|---|---|
| PubChem CID | 74429889 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-ethyl-4-methoxyoxolane-2,3-diol |
| SMILES | CCC1OC(O)C(O)C1OC |
| InChI | InChI=1S/C7H14O4/c1-3-4-6(10-2)5(8)7(9)11-4/h4-9H,3H2,1-2H3 |
| InChIKey | OKJNFPYDXQMDSV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |