C6H11Ac4IO5 — CID 59974133
actinium;(6S)-6-(iodomethyl)oxane-2,3,4,5-tetrol (PubChem CID 59974133) has the molecular formula C6H11Ac4IO5 and a molecular weight of 1198.05 g/mol. Its IUPAC name is actinium;(6S)-6-(iodomethyl)oxane-2,3,4,5-tetrol.
| Compound Name | actinium;(6S)-6-(iodomethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 59974133 |
| Molecular Formula | C6H11Ac4IO5 |
| Molecular Weight | 1198.05 g/mol |
| Exact Mass | 1198.08 |
| IUPAC Name | actinium;(6S)-6-(iodomethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC1O[C@H](CI)C(O)C(O)C1O.[Ac].[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C6H11IO5.4Ac/c7-1-2-3(8)4(9)5(10)6(11)12-2;;;;/h2-6,8-11H,1H2;;;;/t2-,3?,4?,5?,6?;;;;/m1..../s1 |
| InChIKey | GBLDXEOYZCQXIN-IPHVVFBUSA-N |
| XLogP | -1.78 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1198.05 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|