C9H11F3N4O3 — CID 141015012
2-[2-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide (PubChem CID 141015012) has the molecular formula C9H11F3N4O3 and a molecular weight of 280.21 g/mol. Its IUPAC name is 2-[2-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide.
| Compound Name | 2-[2-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide |
|---|---|
| PubChem CID | 141015012 |
| Molecular Formula | C9H11F3N4O3 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[2-[2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]ethylamino]acetamide |
| SMILES | NC(=O)CNCCn1c(=O)cc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H11F3N4O3/c10-9(11,12)5-3-7(18)16(8(19)15-5)2-1-14-4-6(13)17/h3,14H,1-2,4H2,(H2,13,17)(H,15,19) |
| InChIKey | SINXQUFIAGWZLJ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|