C14H10Cl2OP- — CID 141016069
(2,6-dichloro-3-methylphenyl)-phenylphosphanylidenemethanolate (PubChem CID 141016069) has the molecular formula C14H10Cl2OP- and a molecular weight of 296.11 g/mol. Its IUPAC name is (2,6-dichloro-3-methylphenyl)-phenylphosphanylidenemethanolate.
| Compound Name | (2,6-dichloro-3-methylphenyl)-phenylphosphanylidenemethanolate |
|---|---|
| PubChem CID | 141016069 |
| Molecular Formula | C14H10Cl2OP- |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | (2,6-dichloro-3-methylphenyl)-phenylphosphanylidenemethanolate |
| SMILES | Cc1ccc(Cl)c(/C([O-])=P/c2ccccc2)c1Cl |
| InChI | InChI=1S/C14H11Cl2OP/c1-9-7-8-11(15)12(13(9)16)14(17)18-10-5-3-2-4-6-10/h2-8,17H,1H3/p-1 |
| InChIKey | MAWYNEVWHOXHAR-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|