C24H26F6LiO4P — CID 141016860
lithium [2,6-bis(trifluoromethyl)benzoyl]-[2,4,6-tri(propan-2-yloxy)phenyl]phosphanide (PubChem CID 141016860) has the molecular formula C24H26F6LiO4P and a molecular weight of 530.37 g/mol. Its IUPAC name is lithium [2,6-bis(trifluoromethyl)benzoyl]-[2,4,6-tri(propan-2-yloxy)phenyl]phosphanide.
| Compound Name | lithium [2,6-bis(trifluoromethyl)benzoyl]-[2,4,6-tri(propan-2-yloxy)phenyl]phosphanide |
|---|---|
| PubChem CID | 141016860 |
| Molecular Formula | C24H26F6LiO4P |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | lithium [2,6-bis(trifluoromethyl)benzoyl]-[2,4,6-tri(propan-2-yloxy)phenyl]phosphanide |
| SMILES | CC(C)Oc1cc(OC(C)C)c([P-]C(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(OC(C)C)c1.[Li+] |
| InChI | InChI=1S/C24H26F6O4P.Li/c1-12(2)32-15-10-18(33-13(3)4)21(19(11-15)34-14(5)6)35-22(31)20-16(23(25,26)27)8-7-9-17(20)24(28,29)30;/h7-14H,1-6H3;/q-1;+1 |
| InChIKey | RSKATICYUGRRBD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|