C29H38N4O — CID 141019887
4-(diethylaminomethyl)-N-[2-methyl-5-(2-piperidin-2-yl-2H-pyridin-1-yl)phenyl]benzamide (PubChem CID 141019887) has the molecular formula C29H38N4O and a molecular weight of 458.65 g/mol. Its IUPAC name is 4-(diethylaminomethyl)-N-[2-methyl-5-(2-piperidin-2-yl-2H-pyridin-1-yl)phenyl]benzamide.
| Compound Name | 4-(diethylaminomethyl)-N-[2-methyl-5-(2-piperidin-2-yl-2H-pyridin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 141019887 |
| Molecular Formula | C29H38N4O |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 4-(diethylaminomethyl)-N-[2-methyl-5-(2-piperidin-2-yl-2H-pyridin-1-yl)phenyl]benzamide |
| SMILES | CCN(CC)Cc1ccc(C(=O)Nc2cc(N3C=CC=CC3C3CCCCN3)ccc2C)cc1 |
| InChI | InChI=1S/C29H38N4O/c1-4-32(5-2)21-23-13-15-24(16-14-23)29(34)31-27-20-25(17-12-22(27)3)33-19-9-7-11-28(33)26-10-6-8-18-30-26/h7,9,11-17,19-20,26,28,30H,4-6,8,10,18,21H2,1-3H3,(H,31,34) |
| InChIKey | NHQKGWHQYXDABO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |