C25H24N2O3 — CID 141020011
ethyl 2-[4-[[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]amino]phenoxy]acetate (PubChem CID 141020011) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl 2-[4-[[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 141020011 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 2-[4-[[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(N/C(=C2\CNc3ccccc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-2-29-24(28)17-30-20-14-12-19(13-15-20)27-25(18-8-4-3-5-9-18)22-16-26-23-11-7-6-10-21(22)23/h3-15,26-27H,2,16-17H2,1H3/b25-22+ |
| InChIKey | KHVNHZPTIFWMES-YYDJUVGSSA-N |
| XLogP | 5.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|