C9H9N2O3PS — CID 141021896
N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-oxo-4-(oxo-λ5-phosphanylidyne)butanamide (PubChem CID 141021896) has the molecular formula C9H9N2O3PS and a molecular weight of 256.22 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-oxo-4-(oxo-λ5-phosphanylidyne)butanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-oxo-4-(oxo-λ5-phosphanylidyne)butanamide |
|---|---|
| PubChem CID | 141021896 |
| Molecular Formula | C9H9N2O3PS |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-oxo-4-(oxo-λ5-phosphanylidyne)butanamide |
| SMILES | Cc1nc(NC(=O)CC(=O)C#P=O)sc1C |
| InChI | InChI=1S/C9H9N2O3PS/c1-5-6(2)16-9(10-5)11-8(13)3-7(12)4-15-14/h3H2,1-2H3,(H,10,11,13) |
| InChIKey | LVZGQHSOLVRGDI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|