C8H15NO2 — CID 141023692
(2R,3S,4R)-3-(ethylamino)hex-5-yne-2,4-diol (PubChem CID 141023692) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (2R,3S,4R)-3-(ethylamino)hex-5-yne-2,4-diol.
| Compound Name | (2R,3S,4R)-3-(ethylamino)hex-5-yne-2,4-diol |
|---|---|
| PubChem CID | 141023692 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (2R,3S,4R)-3-(ethylamino)hex-5-yne-2,4-diol |
| SMILES | C#C[C@@H](O)[C@@H](NCC)[C@@H](C)O |
| InChI | InChI=1S/C8H15NO2/c1-4-7(11)8(6(3)10)9-5-2/h1,6-11H,5H2,2-3H3/t6-,7-,8+/m1/s1 |
| InChIKey | ARTYLKICSVVHGP-PRJMDXOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|