C6H11NO — CID 141023691
(2R,3R)-3-(methylamino)pent-4-yn-2-ol (PubChem CID 141023691) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (2R,3R)-3-(methylamino)pent-4-yn-2-ol.
| Compound Name | (2R,3R)-3-(methylamino)pent-4-yn-2-ol |
|---|---|
| PubChem CID | 141023691 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (2R,3R)-3-(methylamino)pent-4-yn-2-ol |
| SMILES | C#C[C@@H](NC)[C@@H](C)O |
| InChI | InChI=1S/C6H11NO/c1-4-6(7-3)5(2)8/h1,5-8H,2-3H3/t5-,6-/m1/s1 |
| InChIKey | PDXNXCWXBIRBSA-PHDIDXHHSA-N |
| XLogP | -0.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|