C19H36N2O2S — CID 141027702
tert-butyl 1-thia-8,16-diazaspiro[4.12]heptadecane-15-carboxylate (PubChem CID 141027702) has the molecular formula C19H36N2O2S and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl 1-thia-8,16-diazaspiro[4.12]heptadecane-15-carboxylate.
| Compound Name | tert-butyl 1-thia-8,16-diazaspiro[4.12]heptadecane-15-carboxylate |
|---|---|
| PubChem CID | 141027702 |
| Molecular Formula | C19H36N2O2S |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl 1-thia-8,16-diazaspiro[4.12]heptadecane-15-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCCCCNCCC2(CCCS2)CN1 |
| InChI | InChI=1S/C19H36N2O2S/c1-18(2,3)23-17(22)16-9-6-4-5-7-12-20-13-11-19(15-21-16)10-8-14-24-19/h16,20-21H,4-15H2,1-3H3 |
| InChIKey | HSUBRHUDTCJOJY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |